joshuawtonj56 joshuawtonj56

03-05-2020
Chemistry

contestada

The total mass of the reactants is ________ the total mass of the products in a chemical reaction.

Respuesta :

03-05-2020

Answer:

The total mass of the reactants is equal to the total mass of the products in a chemical reaction.

Explanation:

Answer Link

Otras preguntas

What should be the next number in the following series? 100 96 104 88 120 56_?

Using the electron configuration flow diagram below what is the correct electron configuration for chlorine atomic number 17

Think about a hot air balloon, as the flames heat the gases in the balloon, the volume of the gases increases. At constant pressure, the volume of all gases inc

what are the first 3 terms of n+5 ?

Lines 5-11: Why does the author choose not to reveal the contents of Juan’s letter to Mariana?

cosec(6b+pi/8)=sec(2b-pi/8)

8x² +14 x² -x +35 : 2x+5 Decide

what is the type of international trade

Energy transformations are inefficient and energy transfers are _________. A. Energy transfer B. Inefficient C. Open D. Direction E. Kinetic F. Renewable G. The

y=x2−6x+10 y=4−x How do I substitute?