crazybobcrazy crazybobcrazy

15-02-2017
Spanish

contestada

What is a huipil?

A: skirt
B: sandal
C: blouse
D: hat

Respuesta :

sarastory123 sarastory123

15-02-2017

A huipil is a blouse

Answer Link

kiingbrownn kiingbrownn

15-02-2017

A huipil is a blouse so C

Answer Link

Otras preguntas

Which is the most fundamental chord in music? consonant chord, triad, dissonant chord, dominant chord or arpeggio

in 8 sentences, comment on the following statement... " He who accepts evil without protesting against it is really cooperating with it." (I just need an exampl

What other religions have a connection to Judaism? Christianity Islam Hinduism Buddhism

Historic Westminster Abbey in London, England, has been damaged by the sulfur dioxide and nitrogen oxide in acid rain. This is an example of _____. chemical we

What is the value of x? Enter your answer in the box. x =

What is a video projector used for? A. playing video tapes B. scanning documents into a computer C. projecting a computer image on to a screen D. filming video

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Are all of these answers correct?

which of the three parts of ohm's law is the most dangerous part to humans

The sides of a traingle are in the ratio 3:4:5. what is the length of each sdie of the traingle is 30 cm